(2-Hydroxy-4-nitrophenyl) hydrogen sulfate
(2-hydroxy-4-nitrophenyl) hydrogen sulfate
Also Known As: p-Nitrocatechol sulfate|Pyrocatechol, 4-nitro-, sulfate|2-hydroxy-4-nitro-1-sulfooxy-benzene|Pyrocatechol,4-nitro-,sulfate|(2-hydroxy-4-nitrophenyl) hydrogen sulfate|2-Hydroxy-4-nitrophenyl hydrogen sulfate|Sulfuric acid 2-hydroxy-4-nitrophenyl ester|4-Nitrocatechol sulfate dipotassium salt dihydrate|Sulfuric acid hydrogen 2-hydroxy-4-nitrophenyl ester|(2-HYDROXY-4-NITROPHENYL)OXIDANESULFONIC ACID|1,2-Benzenediol, 4-nitro-, mono(hydrogen sulfate) (ester)
| Molecular Formula | C6H5NO7S |
|---|---|
| Molecular Weight | 234.97867 g/mol |
| LogP | 0.4 |
| Topological Polar Surface Area | 138.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Exact Mass | 234.97867 |
| Monoisotopic Mass | 234.97867 |
| Heavy Atoms | 15 |
| Complexity | 328.0 |
Chemical Identifiers
| CAS Number | 31390-65-5 |
|---|---|
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])O)OS(=O)(=O)O |
| InChIKey | ZVUSRLPQGXIZPO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(2-Hydroxy-4-nitrophenyl) hydrogen sulfate (CAS 31390-65-5), with molecular formula C6H5NO7S and molecular weight 234.97867 g/mol. IUPAC: (2-hydroxy-4-nitrophenyl) hydrogen sulfate.
(2-Hydroxy-4-nitrophenyl) hydrogen sulfate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »