(2E)-3-(3-nitrophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide
(E)-3-(3-nitrophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide
Also Known As: (2E)-3-(3-nitrophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide|BAS 00836201|F0915-5741|SR-01000476450-1|(E)-3-(3-nitrophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide|(E)-3-(3-nitrophenyl)-N-(4-sulfamoylphenyl)acrylamide|3-(3-Nitro-phenyl)-N-(4-sulfamoyl-phenyl)-acrylamide|N-[4-(aminosulfonyl)phenyl]-3-(3-nitrophenyl)acrylamide|amino-p-[(E)-2-(m-nitrophenyl)ethenylcarbonylamino]phenyl(oxo)-lambda-sulfaniumolate
| Molecular Formula | C15H13N3O5S |
|---|---|
| Molecular Weight | 347.0576 g/mol |
| LogP | 1.6 |
| Topological Polar Surface Area | 143.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 347.0576 |
| Monoisotopic Mass | 347.0576 |
| Heavy Atoms | 24 |
| Complexity | 585.0 |
Chemical Identifiers
| CAS Number | 314282-17-2 |
|---|---|
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])/C=C/C(=O)NC2=CC=C(C=C2)S(=O)(=O)N |
| InChIKey | PHANZYFPUIZPCM-RUDMXATFSA-N |
Product Overview
(2E)-3-(3-nitrophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide (CAS 314282-17-2), with molecular formula C15H13N3O5S and molecular weight 347.0576 g/mol. IUPAC: (E)-3-(3-nitrophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide.
(2E)-3-(3-nitrophenyl)-N-(4-sulfamoylphenyl)prop-2-enamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »