1-(5-bromothiophen-2-yl)-N-(3-chloro-2-methylphenyl)methanimine
1-(5-bromothiophen-2-yl)-N-(3-chloro-2-methylphenyl)methanimine
Also Known As: KS-00004C0W|AN-329/11482358|N-[(5-bromo-2-thienyl)methylene]-3-chloro-2-methylaniline|1-(5-bromothiophen-2-yl)-N-(3-chloro-2-methylphenyl)methanimine|N-[(5-bromo-2-thienyl)methylene]-N-(3-chloro-2-methylphenyl)amine|5-[(1E)-2-(3-chloro-2-methylphenyl)-2-azavinyl]-2-bromothiophene|N-[(E)-(5-bromothiophen-2-yl)methylidene]-3-chloro-2-methylaniline
| Molecular Formula | C12H9BrClNS |
|---|---|
| Molecular Weight | 312.93277 g/mol |
| LogP | 5.3 |
| Topological Polar Surface Area | 40.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 312.93277 |
| Monoisotopic Mass | 312.93277 |
| Heavy Atoms | 16 |
| Complexity | 261.0 |
Chemical Identifiers
| CAS Number | 314764-53-9 |
|---|---|
| SMILES | CC1=C(C=CC=C1Cl)N=CC2=CC=C(S2)Br |
| InChIKey | KSMBYCYPEOBNER-UHFFFAOYSA-N |
Product Overview
1-(5-bromothiophen-2-yl)-N-(3-chloro-2-methylphenyl)methanimine (CAS 314764-53-9), with molecular formula C12H9BrClNS and molecular weight 312.93277 g/mol. IUPAC: 1-(5-bromothiophen-2-yl)-N-(3-chloro-2-methylphenyl)methanimine.
1-(5-bromothiophen-2-yl)-N-(3-chloro-2-methylphenyl)methanimine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »