2,4-Dinitro-N-(p-(phenylazo)phenyl)aniline
2,4-dinitro-N-(4-phenyldiazenylphenyl)aniline
Also Known As: 2,4-Dinitro-N-(p-(phenylazo)phenyl)aniline|2,4-Dinitro-4 -(phenylazo)diphenylamine|J1.429.772C|N-[4-(Phenylazo)phenyl]-2,4-dinitroaniline|2,4-dinitro-N-(4-phenyldiazenylphenyl)aniline|2,4-Dinitro-N-(4-[(E)-phenyldiazenyl]phenyl)aniline #|2,4-dinitro-N-[4-(2-phenyldiazen-1-yl)phenyl]aniline|Benzenamine, 2,4-dinitro-N-[4-(2-phenyldiazenyl)phenyl]-|2,4-DINITRO-N-{4-[(1E)-2-PHENYLDIAZEN-1-YL]PHENYL}ANILINE
| Molecular Formula | C18H13N5O4 |
|---|---|
| Molecular Weight | 363.09674 g/mol |
| LogP | 5.3 |
| Topological Polar Surface Area | 128.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Exact Mass | 363.09674 |
| Monoisotopic Mass | 363.09674 |
| Heavy Atoms | 27 |
| Complexity | 533.0 |
Chemical Identifiers
| CAS Number | 315698-69-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NC3=C(C=C(C=C3)[N+](=O)[O-])[N+](=O)[O-] |
| InChIKey | LZAWLDCFKPFYFO-UHFFFAOYSA-N |
Product Overview
2,4-Dinitro-N-(p-(phenylazo)phenyl)aniline (CAS 315698-69-2), with molecular formula C18H13N5O4 and molecular weight 363.09674 g/mol. IUPAC: 2,4-dinitro-N-(4-phenyldiazenylphenyl)aniline.
2,4-Dinitro-N-(p-(phenylazo)phenyl)aniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »