Carbonotrithioic acid, bis(phenylmethyl) ester
bis(benzylsulfanyl)methanethione
Also Known As: dibenzyl carbonotrithioate|bis(benzylsulfanyl)methanethione|S,S-Dibenzyl trithiocarbonate|bis methanethione|Carbonotrithioic acid, bis(phenylmethyl) ester|dibenzyltrithiocarbonate|dibenzylcarbonotrithioate|dibenzyl trithiocarbonate|Trithiocarbonic acid dibenzyl|S,S-DIBENZYLTRITHIOCARBONATE|Trithiocarbonic acid dibenzyl ester|S,S-Dibenzyl trithiocarbonate 97%|S,S-Dibenzyl trithiocarbonate, 97%|Carbonotrithioic acid,bis(phenylmethyl) ester|Dibenzyl trithiocarbonate (High Purity)|(Thioxomethylene)bisthiobismethylenebisbenzene|S,S -Thioxomethylenebis(phenylmethanethiol)|dibenzyl esterCarbonotrithioic acid bis(phenylmethyl) ester/DBTTC/Dibenzyl carbonotrithioate,
| Molecular Formula | C15H14S3 |
|---|---|
| Molecular Weight | 290.02576 g/mol |
| LogP | 5.2 |
| Topological Polar Surface Area | 82.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 290.02576 |
| Monoisotopic Mass | 290.02576 |
| Heavy Atoms | 18 |
| Complexity | 216.0 |
Chemical Identifiers
| CAS Number | 3198-23-0 |
|---|---|
| SMILES | C1=CC=C(C=C1)CSC(=S)SCC2=CC=CC=C2 |
| InChIKey | LAKYXBYUROTWBI-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Carbonotrithioic acid, bis(phenylmethyl) ester (CAS 3198-23-0), with molecular formula C15H14S3 and molecular weight 290.02576 g/mol. IUPAC: bis(benzylsulfanyl)methanethione.