4-Bromo-2-fluoro-6-nitrophenol
4-bromo-2-fluoro-6-nitrophenol
Also Known As: 4-Bromo-2-fluoro-6-nitrophenol|4-bromo-2-fluoro-6-nitro-phenol|ACMC-209xa8|ETHYL2-ETHOXYPROPIONATE|SYNQUEST 4654-B-46|Phenol, 4-bromo-2-fluoro-6-nitro-|4-Brom-2-fluor-6-nitro-phenol|4-bromo-2-fluoro 6-nitrophenol|4-bromo-6-fluoro-2-nitrophenol|KS-00000KAC|AMY8765|2-fluoro-4-bromo-6-nitro-phenol|Phenol,4-bromo-2-fluoro-6-nitro-|4-Bromo-2-fluoro-6-nitrophenol 98%|CS-W006986|4-Bromo-2-fluoro-6-nitrophenol, 97%|5-Bromo-3-fluoro-2-hydroxynitrobenzene|4-BRMO-2-FLRO-6-NTROPHENOL 1G.|4-BRMO-2-FLRO-6-NTROPHENOL 5G.|5-Bromo-1-fluoro-2-hydroxy-3-nitrobenzene
| Molecular Formula | C6H3BrFNO3 |
|---|---|
| Molecular Weight | 234.92802 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 66.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 0 |
| Exact Mass | 234.92802 |
| Monoisotopic Mass | 234.92802 |
| Heavy Atoms | 12 |
| Complexity | 186.0 |
Chemical Identifiers
| CAS Number | 320-76-3 |
|---|---|
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)F)Br |
| InChIKey | ACQVEWFMUBXEMR-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-Bromo-2-fluoro-6-nitrophenol (CAS 320-76-3), with molecular formula C6H3BrFNO3 and molecular weight 234.92802 g/mol. IUPAC: 4-bromo-2-fluoro-6-nitrophenol.