1-Ethenylpyrrolidin-2-one;ethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid
1-ethenylpyrrolidin-2-one;ethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid
Also Known As: Stepanhold extra|Acrylates/PVP copolymer|ACRYLATES / PVP COPOLYMER|(C6-H10-O2.C6-H9-N-O.C4-H6-O2)x-|2-Propenoic acid, 2-methyl-, polymer with 1-ethenyl-2-pyrrolidinone and ethyl 2-methyl-2-propenoate|Methacrylic acid, polymer with ethyl methacrylate and 1-vinyl-2-pyrrolidinone|N-Vinyl-2-pyrolidone, methacrylic acid, ethyl methacrylate polymer|N-Vinyl-2-pyrrolidone, methacrylic acid, ethyl methacrylate polymer|1-Ethenyl-2-pyrrolidinone, methacrylic acid, ethyl methacrylate polymer|1-ethenylpyrrolidin-2-one;ethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid|ethyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid; 1-vinylpyrrolidin-2-one|POLY(ETHYL METHACRYLATE-CO-METHACRYLIC ACID-CO-VINYL-PYRROLIDONE)|1-ethenylpyrrolidin-2-one; ethyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid|2- propenoic acid, 2- methyl- , polymer with 1- ethenyl- 2- pyrrolidinone and ethyl 2- methyl- 2- propenoate
| Molecular Formula | C16H25NO5 |
|---|---|
| Molecular Weight | 311.17328 g/mol |
| LogP | 2.525 |
| Topological Polar Surface Area | 83.9 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 311.17328 |
| Monoisotopic Mass | 311.17328 |
| Heavy Atoms | 22 |
| Complexity | 308.0 |
Chemical Identifiers
| CAS Number | 320-79-6 |
|---|---|
| SMILES | CCOC(=O)C(=C)C.CC(=C)C(=O)O.C=CN1CCCC1=O |
| InChIKey | SKZWEROLFVDCDG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-Ethenylpyrrolidin-2-one;ethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (CAS 320-79-6), with molecular formula C16H25NO5 and molecular weight 311.17328 g/mol. IUPAC: 1-ethenylpyrrolidin-2-one;ethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.