2,3,5,6-Tetrabromo-4-methylphenol
2,3,5,6-tetrabromo-4-methylphenol
Also Known As: 2,3,5,6-Tetrabromo-4-methylphenol|Tetrabrom-p-kresol|tetrabromo-p-cresol|2,3,5,6-Tetrabromo-p-cresol|ACMC-1CSWL|5-Fluoro-2-nitrobenzoic acid|2,3,5,6-tetrabromo-4-methyl-phenol|2,3,5,6-Tetrabromo-4-methylphe|Phenol, 2,3,5,6-tetrabromo-4-methyl-|KS-000011ZG|1961AE|4-methyl-2,3,5,6-tetrabromophenol|Phenol,2,3,5,6-tetrabromo-4-methyl-|2,3,5,6-Tetrabromo-4-methylphenol #|I14-0368|673-672-1|AIDS017754, 2,3,5,6-Tetrabromo-p-cresol, 2,3,5,6-Tetrabromo-4-methylphenol, AIDS-017754, CID458139, ZINC02528072, Phenol, 2,3,5,6-tetrabromo-4-methyl-, 37721-75-8
| Molecular Formula | C7H4Br4O |
|---|---|
| Molecular Weight | 419.6996 g/mol |
| LogP | 4.7 |
| Topological Polar Surface Area | 20.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 419.6996 |
| Monoisotopic Mass | 419.6996 |
| Heavy Atoms | 12 |
| Complexity | 149.0 |
Chemical Identifiers
| CAS Number | 320-98-9 |
|---|---|
| SMILES | CC1=C(C(=C(C(=C1Br)Br)O)Br)Br |
| InChIKey | OMVMKSWFUQZIFD-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,3,5,6-Tetrabromo-4-methylphenol (CAS 320-98-9), with molecular formula C7H4Br4O and molecular weight 419.6996 g/mol. IUPAC: 2,3,5,6-tetrabromo-4-methylphenol.