4-Benzyl-1(2H)-phthalazinone
4-benzyl-2H-phthalazin-1-one
Also Known As: 4-Benzyl-1(2H)-phthalazinone|4-benzylphthalazin-1(2H)-one|4-Benzyl-2H-phthalazin-1-one|benzylphthalazinone|phthalazinone, 1|4-benzyl-phthalazone|4-benzyl-phthalazin-1-one|4-Benzyl-1-phthalazinol|Venadaparib Impurity 19|ChemDiv2_000142|4-benzyl-1,2-dihydrophthalazin-1-one|Oprea1_151142|Oprea1_623913|CBDivE_015258|4-Benzylphthalazine-1(2H)-one|TQP1576|4-benzyl-2-hydrophthalazin-1-one|4-Benzyl-1(2H)-phthalazinone #|4-(Phenylmethyl)-1(2H)-phthalazinone|4-(Phenylmethyl)-2H-phthalazin-1-one|KS-00001Z2N|TD1183|1(2H)-Phthalazinone, 4-(phenylmethyl)-
| Molecular Formula | C15H12N2O |
|---|---|
| Molecular Weight | 236.09496 g/mol |
| LogP | 2.6 |
| Topological Polar Surface Area | 41.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 236.09496 |
| Monoisotopic Mass | 236.09496 |
| Heavy Atoms | 18 |
| Complexity | 344.0 |
Chemical Identifiers
| CAS Number | 32003-14-8 |
|---|---|
| SMILES | C1=CC=C(C=C1)CC2=NNC(=O)C3=CC=CC=C32 |
| InChIKey | JUCCMEHWBGPJKS-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-Benzyl-1(2H)-phthalazinone (CAS 32003-14-8), with molecular formula C15H12N2O and molecular weight 236.09496 g/mol. IUPAC: 4-benzyl-2H-phthalazin-1-one.