5-Fluoro-2-methyl-1H-indene-3-acetic acid
2-(6-fluoro-2-methyl-3H-inden-1-yl)acetic acid
Also Known As: (5-fluoro-2-methyl-1H-inden-3-yl)acetic acid|5-Fluoro-2-methyl-1H-indene-3-acetic acid|2-(5-fluoro-2-methyl-1H-inden-3-yl)acetic acid|Sulindac Impurity 7|2-(6-fluoro-2-methyl-3H-inden-1-yl)acetic acid|5-Fluoro-2-methylindene-3-acetic acid|fluoromethylindenylaceticacid|EINECS 250-891-7|EX-A7997E|KS-00002AYP|1H-Indene-3-acetic acid, 5-fluoro-2-methyl-|FC0666|1-PHENETHYL-PYRROLIDIN-2-ONE|5-fluoro-2-methyl-3-indenyl-acetic acid|CF-1251|CS-W015329|SS-2964|5-fluoro-2-methyl-3-indenylacetic acid|2-(5-Fluoro-2-methyl-3-indenyl)acetic Acid|5-fluoro-2-methylinden-3-yl acetic acid|(6-fluoro-2-methyl-3H-inden-1-yl)acetic acid
| Molecular Formula | C12H11FO2 |
|---|---|
| Molecular Weight | 206.07431 g/mol |
| LogP | 2.63 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 206.07431 |
| Monoisotopic Mass | 206.07431 |
| Heavy Atoms | 15 |
| Complexity | 460.68997 |
Chemical Identifiers
| CAS Number | 32004-66-3 |
|---|---|
| SMILES | CC1=C(C2=C(C1)C=CC(=C2)F)CC(=O)O |
Product Overview
5-Fluoro-2-methyl-1H-indene-3-acetic acid (CAS 32004-66-3), with molecular formula C12H11FO2 and molecular weight 206.07431 g/mol. IUPAC: 2-(6-fluoro-2-methyl-3H-inden-1-yl)acetic acid.