3-Methoxy-17-methylmorphinan-6,14-diol
(1R,9R,10S,13R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol
Also Known As: 3-Methoxy-17-methyl-morphinan-6-beta,14-diol|3-Methoxy-17-methylmorphinan-6,14-diol|3-Methoxy-17-methylmorphinan-6beta,14-diol|Morphinan-6-beta,14-diol, 3-methoxy-17-methyl-|cyclohexane-trans-1,2-dicarboxylic acid dimethyl ester|(1R,9R,10S,13R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-10,13-diol|3-methoxy-11-methyl-5,6,7,8,9,10-hexahydro-8aH-9,4b-(epiminoethano)phenanthrene-6,8a-diol
| Molecular Formula | C18H25NO3 |
|---|---|
| Molecular Weight | 303.18344 g/mol |
| LogP | 1.4691 |
| Topological Polar Surface Area | 52.93 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 303.18344 |
| Monoisotopic Mass | 303.18344 |
| Heavy Atoms | 22 |
| Complexity | 603.9951 |
Chemical Identifiers
| CAS Number | 3205-48-9 |
|---|---|
| SMILES | CN1CC[C@]23C[C@@H](CC[C@]2([C@H]1CC4=C3C=C(C=C4)OC)O)O |
Product Overview
3-Methoxy-17-methylmorphinan-6,14-diol (CAS 3205-48-9), with molecular formula C18H25NO3 and molecular weight 303.18344 g/mol. IUPAC: (1R,9R,10S,13R)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol.