2-(3-oxo-1H-isoindol-2-yl)pentanedioic Acid
2-(3-oxo-1H-isoindol-2-yl)pentanedioic acid
Also Known As: 2-Phthalimidino-glutaric acid|2-(3-oxo-1H-isoindol-2-yl)pentanedioic Acid|2-(1-oxoisoindolin-2-yl)glutaric acid|EM-138|2-(1-oxo-1,3-dihydro-2h-isoindol-2-yl)pentanedioic acid|2-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)pentanedioic acid|2-(1-Oxoisoindolin-2-yl)-glutar-saeure|J1.163.049I|AP-676/40890474|2-(1-Oxo-1,3-dihydro-isoindol-2-yl)-pentanedioic acid|2-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)glutaric acid|2-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)pentanedioicacid|Pentanedioic acid,2-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)-
| Molecular Formula | C13H13NO5 |
|---|---|
| Molecular Weight | 263.07938 g/mol |
| LogP | 0.4 |
| Topological Polar Surface Area | 94.9 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 263.07938 |
| Monoisotopic Mass | 263.07938 |
| Heavy Atoms | 19 |
| Complexity | 394.0 |
Chemical Identifiers
| CAS Number | 32051-72-2 |
|---|---|
| SMILES | C1C2=CC=CC=C2C(=O)N1C(CCC(=O)O)C(=O)O |
| InChIKey | RVTDLRPXGAMZGP-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(3-oxo-1H-isoindol-2-yl)pentanedioic Acid (CAS 32051-72-2), with molecular formula C13H13NO5 and molecular weight 263.07938 g/mol. IUPAC: 2-(3-oxo-1H-isoindol-2-yl)pentanedioic acid.