5,7-Dimethyl-2-(trifluoromethyl)chromen-4-one
5,7-dimethyl-2-(trifluoromethyl)chromen-4-one
Also Known As: 5,7-dimethyl-2-(trifluoromethyl)chromen-4-one|ChemDiv3_002611|5,7-Dimethyl-2-(trifluoromethyl)-4H-chromen-4-one|5,7-dimethyl-2-trifluoromethylchromone|5,7-Dimethyl-2-trifluoromethyl-chromen-4-one|J1.050.033H|4H-1-Benzopyran-4-one, 5,7-dimethyl-2-(trifluoromethyl)-|SR-01000472115-1|BRD-K27160555-001-01-3|5,7-Dimethyl-2-(trifluoromethyl)-4H-chromen-4-one #|2-(Trifluoromethyl)-5,7-dimethyl-4H-1-benzopyran-4-one|5,7-Dimethyl-2-(trifluoromethyl)-4H-1-benzopyran-4-one|A2636/0112221
| Molecular Formula | C12H9F3O2 |
|---|---|
| Molecular Weight | 242.05547 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 0 |
| Exact Mass | 242.05547 |
| Monoisotopic Mass | 242.05547 |
| Heavy Atoms | 17 |
| Complexity | 359.0 |
Chemical Identifiers
| CAS Number | 321-42-6 |
|---|---|
| SMILES | CC1=CC(=C2C(=C1)OC(=CC2=O)C(F)(F)F)C |
| InChIKey | CFVNYDCBJLNXSC-UHFFFAOYSA-N |
Product Overview
5,7-Dimethyl-2-(trifluoromethyl)chromen-4-one (CAS 321-42-6), with molecular formula C12H9F3O2 and molecular weight 242.05547 g/mol. IUPAC: 5,7-dimethyl-2-(trifluoromethyl)chromen-4-one.
5,7-Dimethyl-2-(trifluoromethyl)chromen-4-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »