1-Phenyl-4-[phenyl(phenylsulfanyl)acetyl]piperazine
2-phenyl-1-(4-phenylpiperazin-1-yl)-2-phenylsulfanylethanone
Also Known As: Oprea1_569135|1-phenyl-4-[phenyl(phenylsulfanyl)acetyl]piperazine|1-phenyl-4-[phenyl(phenylthio)acetyl]piperazine|AK-968/13031059|2-phenyl-1-(4-phenylpiperazin-1-yl)-2-phenylsulfanylethanone|2-phenyl-1-(4-phenylpiperazin-1-yl)-2-(phenylsulfanyl)ethanone|2-phenyl-1-(4-phenylpiperazinyl)-2-phenylthioethan-1-one|2-phenyl-1-(4-phenylpiperazin-1-yl)-2-(phenylthio)ethanone|2-PHENYL-1-(4-PHENYLPIPERAZINO)-2-(PHENYLSULFANYL)-1-ETHANONE
| Molecular Formula | C24H24N2OS |
|---|---|
| Molecular Weight | 388.16095 g/mol |
| LogP | 4.8688 |
| Topological Polar Surface Area | 23.55 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 388.16095 |
| Monoisotopic Mass | 388.16095 |
| Heavy Atoms | 28 |
| Complexity | 878.2532 |
Chemical Identifiers
| CAS Number | 32121-52-1 |
|---|---|
| SMILES | C1CN(CCN1C2=CC=CC=C2)C(=O)C(C3=CC=CC=C3)SC4=CC=CC=C4 |
Product Overview
1-Phenyl-4-[phenyl(phenylsulfanyl)acetyl]piperazine (CAS 32121-52-1), with molecular formula C24H24N2OS and molecular weight 388.16095 g/mol. IUPAC: 2-phenyl-1-(4-phenylpiperazin-1-yl)-2-phenylsulfanylethanone.
1-Phenyl-4-[phenyl(phenylsulfanyl)acetyl]piperazine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »