Dimethyl 3-methoxyphthalate
dimethyl 3-methoxybenzene-1,2-dicarboxylate
Also Known As: dimethyl 3-methoxyphthalate|dimethyl 3-methoxybenzene-1,2-dicarboxylate|3-Methoxyphthalic acid dimethyl ester|methoxybenzenedicarboxylic acid dimethyl ester|1,2-Benzenedicarboxylicacid, 3-methoxy-, 1,2-dimethyl ester|1,2-dimethyl 3-methoxybenzene-1,2-dicarboxylate|1,2-Benzenedicarboxylic acid, 3-methoxy-, 1,2-dimethyl ester|3-methoxy-benzene-1,2-dicarboxylic acid dimethyl ester|1,2-Benzenedicarboxylicacid,3-methoxy-,1,2-dimethyl ester|Benzene-1,2-dicarboxylic acid, 3-methoxy, dimethyl ester
| Molecular Formula | C11H12O5 |
|---|---|
| Molecular Weight | 224.06847 g/mol |
| LogP | 1.9 |
| Topological Polar Surface Area | 61.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 224.06847 |
| Monoisotopic Mass | 224.06847 |
| Heavy Atoms | 16 |
| Complexity | 263.0 |
Chemical Identifiers
| CAS Number | 32136-52-0 |
|---|---|
| SMILES | COC1=CC=CC(=C1C(=O)OC)C(=O)OC |
| InChIKey | KKSNRHOMXHCRGF-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Dimethyl 3-methoxyphthalate (CAS 32136-52-0), with molecular formula C11H12O5 and molecular weight 224.06847 g/mol. IUPAC: dimethyl 3-methoxybenzene-1,2-dicarboxylate.