(E)-4-((3-cyano-4,5-dimethylthiophen-2-yl)amino)-4-oxobut-2-enoic acid
(E)-4-[(3-cyano-4,5-dimethylthiophen-2-yl)amino]-4-oxobut-2-enoic acid
Also Known As: NCGC00173670-01|(2E)-3-[(3-CYANO-4,5-DIMETHYLTHIOPHEN-2-YL)CARBAMOYL]PROP-2-ENOIC ACID|AG-205/08691001|SR-01000396807-1|(E)-4-((3-cyano-4,5-dimethylthiophen-2-yl)amino)-4-oxobut-2-enoic acid|F0777-0399|(E)-4-[(3-cyano-4,5-dimethylthiophen-2-yl)amino]-4-oxobut-2-enoic acid|(2E)-4-[(3-CYANO-4,5-DIMETHYL-2-THIENYL)AMINO]-4-OXO-2-BUTENOIC ACID
| Molecular Formula | C11H10N2O3S |
|---|---|
| Molecular Weight | 250.04121 g/mol |
| LogP | 1.9 |
| Topological Polar Surface Area | 118.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 250.04121 |
| Monoisotopic Mass | 250.04121 |
| Heavy Atoms | 17 |
| Complexity | 399.0 |
Chemical Identifiers
| CAS Number | 321966-87-4 |
|---|---|
| SMILES | CC1=C(SC(=C1C#N)NC(=O)/C=C/C(=O)O)C |
| InChIKey | XPBVVJQMUUACRY-ONEGZZNKSA-N |
Product Overview
(E)-4-((3-cyano-4,5-dimethylthiophen-2-yl)amino)-4-oxobut-2-enoic acid (CAS 321966-87-4), with molecular formula C11H10N2O3S and molecular weight 250.04121 g/mol. IUPAC: (E)-4-[(3-cyano-4,5-dimethylthiophen-2-yl)amino]-4-oxobut-2-enoic acid.
(E)-4-((3-cyano-4,5-dimethylthiophen-2-yl)amino)-4-oxobut-2-enoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »