Nitrone, alpha-phenyl-N-p-tolyl-
N-(4-methylphenyl)-1-phenylmethanimine oxide
Also Known As: Nitrone, alpha-phenyl-N-p-tolyl-|alpha-Phenyl-N-p-tolylnitrone|alpha-Phenyl-N-4-tolylnitrone|4-Methyl-N-benzylideneaniline N-oxide|N-Benzylidene-4-methylaniline N-oxide|(4-Methylphenyl)benzylideneamine N-oxide|N-(4-methylphenyl)-1-phenylmethanimine oxide|N-Benzylidene-4-methylphenylamine N-oxide|Benzenamine, 4-methyl-N-(phenylmethylene)-, N-oxide|N-(4-Methylphenyl)phenylmethanimine N-oxide|N-(4-Methylphenyl)benzenemethanimine N-oxide|N-Benzylidene-N-(4-methylphenyl)amine oxide|N-(4-Methylphenyl)-N-oxylatobenzylideneiminium|Benzenamine, 4-methyl-N-(phenylmethylene)-, N-oxide, (N(Z))-|Benzenamine, 4-methyl-N-(phenylmethylene)-, N-oxide, [N(Z)]-
| Molecular Formula | C14H13NO |
|---|---|
| Molecular Weight | 211.09972 g/mol |
| LogP | 3.25592 |
| Topological Polar Surface Area | 26.07 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 211.09972 |
| Monoisotopic Mass | 211.09972 |
| Heavy Atoms | 16 |
| Complexity | 485.9036 |
Chemical Identifiers
| CAS Number | 32213-72-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)/[N+](=C/C2=CC=CC=C2)/[O-] |
Product Overview
Nitrone, alpha-phenyl-N-p-tolyl- (CAS 32213-72-2), with molecular formula C14H13NO and molecular weight 211.09972 g/mol. IUPAC: N-(4-methylphenyl)-1-phenylmethanimine oxide.