Ethenyl acetate;2-ethylhexyl prop-2-enoate;methyl 2-methylprop-2-enoate
ethenyl acetate;2-ethylhexyl prop-2-enoate;methyl 2-methylprop-2-enoate
Also Known As: (C11-H20-O2.C5-H8-O2.C4-H6-O2)x-|2-ethylhexyl prop-2-enoate; methyl 2-methylprop-2-enoate; vinyl acetate|Ethenyl Acetate; 2-ethylhexyl Prop-2-enoate; Methyl 2-methylprop-2-enoate|ethenyl acetate;2-ethylhexyl prop-2-enoate;methyl 2-methylprop-2-enoate|2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethenyl acetate and 2-ethylhexyl 2-propenoate|2-Propenoic acid,2-methyl-,esters,methyl ester,polymer with ethenyl acetate and 2-ethylhexyl 2-propenoate
| Molecular Formula | C20H34O6 |
|---|---|
| Molecular Weight | 370.23553 g/mol |
| LogP | 4.3605 |
| Topological Polar Surface Area | 78.9 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Exact Mass | 370.23553 |
| Monoisotopic Mass | 370.23553 |
| Heavy Atoms | 26 |
| Complexity | 312.0 |
Chemical Identifiers
| CAS Number | 32305-33-2 |
|---|---|
| SMILES | CCCCC(CC)COC(=O)C=C.CC(=C)C(=O)OC.CC(=O)OC=C |
| InChIKey | ZWOBOGKYUUUUAL-UHFFFAOYSA-N |
Product Overview
Ethenyl acetate;2-ethylhexyl prop-2-enoate;methyl 2-methylprop-2-enoate (CAS 32305-33-2), with molecular formula C20H34O6 and molecular weight 370.23553 g/mol. IUPAC: ethenyl acetate;2-ethylhexyl prop-2-enoate;methyl 2-methylprop-2-enoate.