N-(5-chloropyridin-2-yl)-1-(3-methylthiophen-2-yl)methanimine
N-(5-chloro-2-pyridinyl)-1-(3-methylthiophen-2-yl)methanimine
Also Known As: IFLab1_000909|(1E)-N-(5-CHLOROPYRIDIN-2-YL)-1-(3-METHYLTHIOPHEN-2-YL)METHANIMINE|F0286-0112|N-(5-chloropyridin-2-yl)-1-(3-methylthiophen-2-yl)methanimine|(E)-N-(5-chloropyridin-2-yl)-1-(3-methylthiophen-2-yl)methanimine|A1543/0067115|(E)-5-chloro-N-((3-methylthiophen-2-yl)methylene)pyridin-2-amine|2-[(1E)-2-(5-chloro(2-pyridyl))-2-azavinyl]-3-methylthiophene|N-(5-CHLORO-2-PYRIDYL)-N-[(E)-1-(3-METHYL-2-THIENYL)METHYLIDENE]AMINE
| Molecular Formula | C11H9ClN2S |
|---|---|
| Molecular Weight | 236.0175 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 53.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 236.0175 |
| Monoisotopic Mass | 236.0175 |
| Heavy Atoms | 15 |
| Complexity | 235.0 |
Chemical Identifiers
| CAS Number | 324058-74-4 |
|---|---|
| SMILES | CC1=C(SC=C1)C=NC2=NC=C(C=C2)Cl |
| InChIKey | SCZQIMGVVBLAKV-UHFFFAOYSA-N |
Product Overview
N-(5-chloropyridin-2-yl)-1-(3-methylthiophen-2-yl)methanimine (CAS 324058-74-4), with molecular formula C11H9ClN2S and molecular weight 236.0175 g/mol. IUPAC: N-(5-chloro-2-pyridinyl)-1-(3-methylthiophen-2-yl)methanimine.
N-(5-chloropyridin-2-yl)-1-(3-methylthiophen-2-yl)methanimine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »