3-(4-Propoxyphenyl)propanoic acid
3-(4-propoxyphenyl)propanoic acid
Also Known As: 3-(4-propoxyphenyl)propanoic acid|3- propionicacid|4-Propoxy-benzenepropanoic acid|CBMicro_011397|Benzenepropanoic acid,4-propoxy-|Oprea1_791348|Oprea1_845300|3-(4-propoxyphenyl)propanoicacid|4-Propoxybenzenepropanoic acid|3-(4-Propoxy-phenyl)-propionic acid|3-(4-PROPOXYPHENYL)PROPIONIC ACID|3-(4-n-Propoxyphenyl)propionic acid|3-(4-n-Propoxyphenyl)propanoic acid|BAS 00294099|3-(4-N-PROPOXYPHENL)PROPION 1G.|3-(4-N-PROPOXYPHENL)PROPION 5G.|BIM-0011360.P001|3-(4-n-Propoxyphenyl)propionic acid =96%|K-7542|AB00074582-01|AG-690/08755023|BRD-K25515438-001-09-6
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.10994 g/mol |
| LogP | 2.4926 |
| Topological Polar Surface Area | 46.53 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Exact Mass | 208.10994 |
| Monoisotopic Mass | 208.10994 |
| Heavy Atoms | 15 |
| Complexity | 303.1482 |
Chemical Identifiers
| CAS Number | 3243-40-1 |
|---|---|
| SMILES | CCCOC1=CC=C(C=C1)CCC(=O)O |
Product Overview
3-(4-Propoxyphenyl)propanoic acid (CAS 3243-40-1), with molecular formula C12H16O3 and molecular weight 208.10994 g/mol. IUPAC: 3-(4-propoxyphenyl)propanoic acid.