Cyclopropanecarbonitrile, 1-(p-chlorophenyl)-2-phenyl-
1-(4-chlorophenyl)-2-phenylcyclopropane-1-carbonitrile
Also Known As: Cyclopropanecarbonitrile, 1-(p-chlorophenyl)-2-phenyl-|1-(4-chlorophenyl)-2-phenylcyclopropane-1-carbonitrile|1-(4-Chlorophenyl)-2-phenylcyclopropanecarbonitrile|1-(p-Chlorophenyl)-2-phenylcyclopropanecarbonitrile|1-(4-Chlorophenyl)-2-phenylcyclopropanecarbonitrile #|Cyclopropanecarbonitrile,1-(4-chlorophenyl)-2-phenyl-|Cyclopropanecarbonitrile,1-(p-chlorophenyl)-2-(p-methoxyphenyl)|1-(4-CHLOROPHENYL)-2-PHENYL-CYCLOPROPANE-1-CARBONITRILE
| Molecular Formula | C16H12ClN |
|---|---|
| Molecular Weight | 253.06583 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 23.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 253.06583 |
| Monoisotopic Mass | 253.06583 |
| Heavy Atoms | 18 |
| Complexity | 343.0 |
Chemical Identifiers
| CAS Number | 32589-55-2 |
|---|---|
| SMILES | C1C(C1(C#N)C2=CC=C(C=C2)Cl)C3=CC=CC=C3 |
| InChIKey | WNUOJHANAJTNCJ-UHFFFAOYSA-N |
Product Overview
Cyclopropanecarbonitrile, 1-(p-chlorophenyl)-2-phenyl- (CAS 32589-55-2), with molecular formula C16H12ClN and molecular weight 253.06583 g/mol. IUPAC: 1-(4-chlorophenyl)-2-phenylcyclopropane-1-carbonitrile.
Cyclopropanecarbonitrile, 1-(p-chlorophenyl)-2-phenyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »