3,4-Dichloro-N-(1-(1-methylethyl)-2-pyrrolidinylidene)benzenamine
N-(3,4-dichlorophenyl)-1-propan-2-ylpyrrolidin-2-imine
Also Known As: 3,4-Dichloro-N-(1-(1-methylethyl)-2-pyrrolidinylidene)benzenamine|N-(3,4-dichlorophenyl)-1-propan-2-ylpyrrolidin-2-imine|Pyrrolidine, 2-((3,4-dichlorophenyl)imino)-1-(1-methylethyl)-|Benzenamine, 3,4-dichloro-N-(1-(1-methylethyl)-2-pyrrolidinylidene)-|3,4-dichloro-n-[(2e)-1-(propan-2-yl)pyrrolidin-2-ylidene]aniline
| Molecular Formula | C13H16Cl2N2 |
|---|---|
| Molecular Weight | 270.06906 g/mol |
| LogP | 3.7 |
| Topological Polar Surface Area | 15.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 270.06906 |
| Monoisotopic Mass | 270.06906 |
| Heavy Atoms | 17 |
| Complexity | 291.0 |
Chemical Identifiers
| CAS Number | 326-08-9 |
|---|---|
| SMILES | CC(C)N1CCCC1=NC2=CC(=C(C=C2)Cl)Cl |
| InChIKey | YQBGWRXROMKLMU-UHFFFAOYSA-N |
Product Overview
3,4-Dichloro-N-(1-(1-methylethyl)-2-pyrrolidinylidene)benzenamine (CAS 326-08-9), with molecular formula C13H16Cl2N2 and molecular weight 270.06906 g/mol. IUPAC: N-(3,4-dichlorophenyl)-1-propan-2-ylpyrrolidin-2-imine.
3,4-Dichloro-N-(1-(1-methylethyl)-2-pyrrolidinylidene)benzenamine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »