4,4'-Diacetoxybiphenyl
[4-(4-acetyloxyphenyl)phenyl] acetate
Also Known As: 4,4'-Diacetoxybiphenyl|[1,1'-Biphenyl]-4,4'-diyl diacetate|4,4-diacetoxybiphenyl|4,4'-Biphenol Diacetate|ACMC-1AGCM|4,4'-diacetoxy-biphenyl|4,4 -Diacetoxybiphenyl|4,4'- Biphenyl diacetate|[4-(4-acetyloxyphenyl)phenyl] acetate|Oprea1_036926|Oprea1_791971|4,4 -Biphenol diacetate|4,4'-Biphenyldiyl diacetate|biphenyl-4,4'-diyl diacetate|4,4 -Biphenyldiol diacetate|4,4'-Diacetoxy-1,1'-biphenyl|Biphenyl-4,4 -diol diacetate|KS-000015CN|4,4'-DIACETOXYBIPHNL 25GM|4-(4-acetyloxyphenyl)phenyl acetate|Diacetic acid 4,4 -biphenyldiyl|[4-(4-acetoxyphenyl)phenyl] acetate|Bisacetic acid 4,4 -biphenylylene|Diacetic acid biphenyl-4,4 -diyl|4,4'-DIACETOXYBIPHENYL|4-[4-(acetyloxy)phenyl]phenyl acetate|[1,1'-Biphenyl]-4,4'-diyldiacetate|2-(2-METHYLBENZYL)-MALONICACID|4,4 -Diacetoxy-1,1 -biphenyl|Acetic acid 4'-acetoxy-biphenyl-4-yl ester|BAS 00093749
| Molecular Formula | C16H14O4 |
|---|---|
| Molecular Weight | 270.0892 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 270.0892 |
| Monoisotopic Mass | 270.0892 |
| Heavy Atoms | 20 |
| Complexity | 302.0 |
Chemical Identifiers
| CAS Number | 32604-29-8 |
|---|---|
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C |
| InChIKey | RQMBBMQDXFZFCC-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 12 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4,4'-Diacetoxybiphenyl (CAS 32604-29-8), with molecular formula C16H14O4 and molecular weight 270.0892 g/mol. IUPAC: [4-(4-acetyloxyphenyl)phenyl] acetate.