Pyrazole-4-acetic acid, 3-methyl-1,5-diphenyl-
2-(3-methyl-1,5-diphenylpyrazol-4-yl)acetic acid
Also Known As: Pyrazole-4-acetic acid, 3-methyl-1,5-diphenyl-|1,5-Diphenyl-3-methyl-1H-pyrazole-4-aceticacid|3-methyl-1,5-diphenyl-pyrazol-4-acetic acid|1H-Pyrazole-4-acetic acid, 3-methyl-1,5-diphenyl-|1,5-Diphenyl-3-methyl-1H-pyrazole-4-acetic acid|3-Methyl-1,5-diphenyl-1H-pyrazole-4-acetic acid|2-(3-methyl-1,5-diphenylpyrazol-4-yl)acetic acid|(3-Methyl-1,5-diphenyl-1H-pyrazol-4-yl)acetic acid|(3-Methyl-1,5-diphenyl-1H-pyrazol-4-yl)acetic acid #|2-(3-methyl-1,5-diphenyl-1H-pyrazol-4-yl)acetic acid
| Molecular Formula | C18H16N2O2 |
|---|---|
| Molecular Weight | 292.1212 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 55.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 292.1212 |
| Monoisotopic Mass | 292.1212 |
| Heavy Atoms | 22 |
| Complexity | 375.0 |
Chemical Identifiers
| CAS Number | 32701-85-2 |
|---|---|
| SMILES | CC1=NN(C(=C1CC(=O)O)C2=CC=CC=C2)C3=CC=CC=C3 |
| InChIKey | GGNXUKNMTXCEDC-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Pyrazole-4-acetic acid, 3-methyl-1,5-diphenyl- (CAS 32701-85-2), with molecular formula C18H16N2O2 and molecular weight 292.1212 g/mol. IUPAC: 2-(3-methyl-1,5-diphenylpyrazol-4-yl)acetic acid.