AC1LTIZ2
ethyl 2-[[(E)-2-cyano-3-(2-phenylmethoxyphenyl)prop-2-enoyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate
Also Known As: ethyl 2-({(2E)-3-[2-(benzyloxy)phenyl]-2-cyanoprop-2-enoyl}amino)-4-(4-methylphenyl)thiophene-3-carboxylate|ethyl 2-[[(E)-2-cyano-3-(2-phenylmethoxyphenyl)prop-2-enoyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate|(E)-ethyl 2-(3-(2-(benzyloxy)phenyl)-2-cyanoacrylamido)-4-(p-tolyl)thiophene-3-carboxylate|ethyl 2-{(2E)-2-cyano-3-[2-(phenylmethoxy)phenyl]prop-2-enoylamino}-4-(4-methy lphenyl)thiophene-3-carboxylate
| Molecular Formula | C31H26N2O4S |
|---|---|
| Molecular Weight | 522.1613 g/mol |
| LogP | 7.0249 |
| Topological Polar Surface Area | 88.42 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Exact Mass | 522.1613 |
| Monoisotopic Mass | 522.1613 |
| Heavy Atoms | 38 |
| Complexity | 1499.134 |
Chemical Identifiers
| CAS Number | 327075-72-9 |
|---|---|
| SMILES | CCOC(=O)C1=C(SC=C1C2=CC=C(C=C2)C)NC(=O)/C(=C/C3=CC=CC=C3OCC4=CC=CC=C4)/C#N |
Product Overview
AC1LTIZ2 (CAS 327075-72-9), with molecular formula C31H26N2O4S and molecular weight 522.1613 g/mol. IUPAC: ethyl 2-[[(E)-2-cyano-3-(2-phenylmethoxyphenyl)prop-2-enoyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.