5-[(5-Bromothiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione
5-[(5-bromothiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione
Also Known As: KS-00004CXJ|BAS 00867957|5-[(5-bromothiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione|F3146-3869|SR-01000316796-1|5-[(5-bromo-2-thienyl)methylene]-2,4,6(1H,3H,5H)-pyrimidinetrione|5-((5-bromothiophen-2-yl)methylene)pyrimidine-2,4,6(1H,3H,5H)-trione|5-(5-Bromo-thiophen-2-ylmethylene)-pyrimidine-2,4,6-trione|5-[(5-bromo-2-thienyl)methylene]-1,3-dihydropyrimidine-2,4,6-trione|5-[(5-bromothiophen-2-yl)methylidene]pyrimidine-2,4,6(1H,3H,5H)-trione
| Molecular Formula | C9H5BrN2O3S |
|---|---|
| Molecular Weight | 299.92044 g/mol |
| LogP | 1.26 |
| Topological Polar Surface Area | 75.27 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 299.92044 |
| Monoisotopic Mass | 299.92044 |
| Heavy Atoms | 16 |
| Complexity | 498.5787 |
Chemical Identifiers
| CAS Number | 328024-18-6 |
|---|---|
| SMILES | C1=C(SC(=C1)Br)C=C2C(=O)NC(=O)NC2=O |
Product Overview
5-[(5-Bromothiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione (CAS 328024-18-6), with molecular formula C9H5BrN2O3S and molecular weight 299.92044 g/mol. IUPAC: 5-[(5-bromothiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione.