CBMicro_025363
N-(2-methylphenyl)-2-[(4-nitrobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide
Also Known As: CBMicro_025363|Oprea1_351386|Oprea1_354876|BAS 00486736|BIM-0025322.P001|SR-01000424180-1|N-(2-methylphenyl)-2-[(4-nitrobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide|N-(2-methylphenyl)-2-{[(4-nitrophenyl)carbonyl]amino}-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide|N-(2-methylphenyl){2-[(4-nitrophenyl)carbonylamino](4,5,6,7,8-pentahydrocycloh epta[1,2-b]thiophen-3-yl)}carboxamide
| Molecular Formula | C24H23N3O4S |
|---|---|
| Molecular Weight | 449.14093 g/mol |
| LogP | 5.73822 |
| Topological Polar Surface Area | 101.34 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 449.14093 |
| Monoisotopic Mass | 449.14093 |
| Heavy Atoms | 32 |
| Complexity | 1184.4551 |
Chemical Identifiers
| CAS Number | 329068-42-0 |
|---|---|
| SMILES | CC1=CC=CC=C1NC(=O)C2=C(SC3=C2CCCCC3)NC(=O)C4=CC=C(C=C4)[N+](=O)[O-] |
Product Overview
CBMicro_025363 (CAS 329068-42-0), with molecular formula C24H23N3O4S and molecular weight 449.14093 g/mol. IUPAC: N-(2-methylphenyl)-2-[(4-nitrobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide.