1-[({[4-(Tert-butyl)cyclohexyliden]amino}oxy)carbonyl]-3-nitrobenzene
[(4-tert-butylcyclohexylidene)amino] 3-nitrobenzoate
Also Known As: KS-000026SW|(4-tert-butylcyclohexylidene)amino 3-nitrobenzoate|JS-0688|[(4-tert-butylcyclohexylidene)amino] 3-nitrobenzoate|1-[({[4-(tert-butyl)cyclohexyliden]amino}oxy)carbonyl]-3-nitrobenzene|(4-tert-butylcyclohexylidene)amino3-nitrobenzoate|4-tert-butylcyclohexanone O-(3-nitrobenzoyl)oxime|4-tert-butylcyclohexanone O-{3-nitrobenzoyl}oxime|AA-768/32246030|SR-01000307745-1|[4-(tert-butyl)cyclohexylidene]azamethyl 3-nitrobenzoate
| Molecular Formula | C17H22N2O4 |
|---|---|
| Molecular Weight | 318.15796 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 84.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 318.15796 |
| Monoisotopic Mass | 318.15796 |
| Heavy Atoms | 23 |
| Complexity | 466.0 |
Chemical Identifiers
| CAS Number | 329079-55-2 |
|---|---|
| SMILES | CC(C)(C)C1CCC(=NOC(=O)C2=CC(=CC=C2)[N+](=O)[O-])CC1 |
| InChIKey | XXVIMRQTPCMYIX-UHFFFAOYSA-N |
Product Overview
1-[({[4-(Tert-butyl)cyclohexyliden]amino}oxy)carbonyl]-3-nitrobenzene (CAS 329079-55-2), with molecular formula C17H22N2O4 and molecular weight 318.15796 g/mol. IUPAC: [(4-tert-butylcyclohexylidene)amino] 3-nitrobenzoate.
1-[({[4-(Tert-butyl)cyclohexyliden]amino}oxy)carbonyl]-3-nitrobenzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »