2-[(2-Fluorobenzyl)sulfanyl]-6-(4-fluorophenyl)-4-phenylpyridine-3-carbonitrile
6-(4-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-4-phenylpyridine-3-carbonitrile
Also Known As: Oprea1_188337|AK-777/09837038|2-((2-fluorobenzyl)thio)-6-(4-fluorophenyl)-4-phenylnicotinonitrile|2-[(2-fluorobenzyl)sulfanyl]-6-(4-fluorophenyl)-4-phenylnicotinonitrile|2-[(2-fluorobenzyl)sulfanyl]-6-(4-fluorophenyl)-4-phenylpyridine-3-carbonitrile|6-(4-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-4-phenylpyridine-3-carbonitrile
| Molecular Formula | C25H16F2N2S |
|---|---|
| Molecular Weight | 414.10022 g/mol |
| LogP | 6.85778 |
| Topological Polar Surface Area | 36.68 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 414.10022 |
| Monoisotopic Mass | 414.10022 |
| Heavy Atoms | 30 |
| Complexity | 1216.3491 |
Chemical Identifiers
| CAS Number | 330180-06-8 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=C2C#N)SCC3=CC=CC=C3F)C4=CC=C(C=C4)F |
Product Overview
2-[(2-Fluorobenzyl)sulfanyl]-6-(4-fluorophenyl)-4-phenylpyridine-3-carbonitrile (CAS 330180-06-8), with molecular formula C25H16F2N2S and molecular weight 414.10022 g/mol. IUPAC: 6-(4-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-4-phenylpyridine-3-carbonitrile.
2-[(2-Fluorobenzyl)sulfanyl]-6-(4-fluorophenyl)-4-phenylpyridine-3-carbonitrile is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »