1,2-Bis(4-chlorophenyl)-1-(pyridin-4-ylmethyl)hydrazine
1,2-bis(4-chlorophenyl)-1-(pyridin-4-ylmethyl)hydrazine
Also Known As: 1,2-bis(4-chlorophenyl)-1-(pyridin-4-ylmethyl)hydrazine|4-{[1,2-bis(4-chlorophenyl)hydrazinyl]methyl}pyridine|1,2-bis(2-chlorophenyl)-1-(diphenylmethyl)hydrazine|1,2-bis(4-chlorophenyl)-1-(4-pyridylmethyl)hydrazine|1,2-bis(4-chlorophenyl)-1-(pyridin-4-ylmethyl)diazane|4-{[1,2-BIS(4-CHLOROPHENYL)HYDRAZIN-1-YL]METHYL}PYRIDINE
| Molecular Formula | C18H15Cl2N3 |
|---|---|
| Molecular Weight | 343.0643 g/mol |
| LogP | 5.6 |
| Topological Polar Surface Area | 28.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 343.0643 |
| Monoisotopic Mass | 343.0643 |
| Heavy Atoms | 23 |
| Complexity | 333.0 |
Chemical Identifiers
| CAS Number | 33021-75-9 |
|---|---|
| SMILES | C1=CC(=CC=C1NN(CC2=CC=NC=C2)C3=CC=C(C=C3)Cl)Cl |
| InChIKey | RVFRHSFHAZEEQE-UHFFFAOYSA-N |
Product Overview
1,2-Bis(4-chlorophenyl)-1-(pyridin-4-ylmethyl)hydrazine (CAS 33021-75-9), with molecular formula C18H15Cl2N3 and molecular weight 343.0643 g/mol. IUPAC: 1,2-bis(4-chlorophenyl)-1-(pyridin-4-ylmethyl)hydrazine.
1,2-Bis(4-chlorophenyl)-1-(pyridin-4-ylmethyl)hydrazine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »