![(2,4-Dimethoxyphenyl)[4-(morpholin-4-yl)phenyl]methanone structure](/static/products/330/330675-45-1.png)
(2,4-Dimethoxyphenyl)[4-(morpholin-4-yl)phenyl]methanone
(2,4-dimethoxyphenyl)-(4-morpholin-4-ylphenyl)methanone
Also Known As: Oprea1_244413|NCGC00020996-01|NCGC00020996-02|2,4-Dimethoxy-4 -morpholinobenzophenone|J3.037.470C|(2,4-dimethoxyphenyl)(4-morpholinophenyl)methanone|4-[4-(2,4-DIMETHOXYBENZOYL)PHENYL]MORPHOLINE|(2,4-dimethoxyphenyl)-(4-morpholin-4-ylphenyl)methanone|(2,4-dimethoxyphenyl)[4-(morpholin-4-yl)phenyl]methanone
| Molecular Formula | C19H21NO4 |
|---|---|
| Molecular Weight | 327.14706 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 48.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 327.14706 |
| Monoisotopic Mass | 327.14706 |
| Heavy Atoms | 24 |
| Complexity | 402.0 |
Chemical Identifiers
| CAS Number | 330675-45-1 |
|---|---|
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=C(C=C2)N3CCOCC3)OC |
| InChIKey | UZYJSOYGOYCCSO-UHFFFAOYSA-N |
Product Overview
(2,4-Dimethoxyphenyl)[4-(morpholin-4-yl)phenyl]methanone (CAS 330675-45-1), with molecular formula C19H21NO4 and molecular weight 327.14706 g/mol. IUPAC: (2,4-dimethoxyphenyl)-(4-morpholin-4-ylphenyl)methanone.
(2,4-Dimethoxyphenyl)[4-(morpholin-4-yl)phenyl]methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »