3-[N-({4-[(dimethylamino)diazenyl]phenyl}sulfonyl)carbamoyl]propanoic acid
4-[[4-(dimethylaminodiazenyl)phenyl]sulfonylamino]-4-oxobutanoic acid
Also Known As: BAS 00608562|SR-01000362127-1|3-[N-({4-[(dimethylamino)diazenyl]phenyl}sulfonyl)carbamoyl]propanoic acid|4-[[4-(dimethylaminodiazenyl)phenyl]sulfonylamino]-4-oxobutanoic acid|(E)-4-(4-(3,3-dimethyltriaz-1-en-1-yl)phenylsulfonamido)-4-oxobutanoic acid|4-[({4-[(1E)-3,3-dimethyltriaz-1-en-1-yl]phenyl}sulfonyl)amino]-4-oxobutanoic acid
| Molecular Formula | C12H16N4O5S |
|---|---|
| Molecular Weight | 328.08414 g/mol |
| LogP | 0.9166 |
| Topological Polar Surface Area | 128.5 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Exact Mass | 328.08414 |
| Monoisotopic Mass | 328.08414 |
| Heavy Atoms | 22 |
| Complexity | 667.26196 |
Chemical Identifiers
| CAS Number | 331836-75-0 |
|---|---|
| SMILES | CN(C)N=NC1=CC=C(C=C1)S(=O)(=O)NC(=O)CCC(=O)O |
Product Overview
3-[N-({4-[(dimethylamino)diazenyl]phenyl}sulfonyl)carbamoyl]propanoic acid (CAS 331836-75-0), with molecular formula C12H16N4O5S and molecular weight 328.08414 g/mol. IUPAC: 4-[[4-(dimethylaminodiazenyl)phenyl]sulfonylamino]-4-oxobutanoic acid.
3-[N-({4-[(dimethylamino)diazenyl]phenyl}sulfonyl)carbamoyl]propanoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »