AC1NUGZQ
ethyl 4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzoate
Also Known As: (E)-ethyl 4-(((3-methyl-5-oxo-1-(p-tolyl)-1H-pyrazol-4(5H)-ylidene)methyl)amino)benzoate|ethyl 4-[[(E)-[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methyl]amino]benzoate|ethyl 4-[[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methylamino]benzoate|ethyl 4-({(E)-[3-methyl-1-(4-methylphenyl)-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]methyl}amino)benzoate|ETHYL 4-({[3-METHYL-1-(4-METHYLPHENYL)-5-OXO-1,5-DIHYDRO-4H-PYRAZOL-4-YLIDEN]METHYL}AMINO)BENZOATE
| Molecular Formula | C21H21N3O3 |
|---|---|
| Molecular Weight | 363.1583 g/mol |
| LogP | 3.70974 |
| Topological Polar Surface Area | 76.45 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 363.1583 |
| Monoisotopic Mass | 363.1583 |
| Heavy Atoms | 27 |
| Complexity | 1026.0289 |
Chemical Identifiers
| CAS Number | 332017-40-0 |
|---|---|
| SMILES | CCOC(=O)C1=CC=C(C=C1)N=CC2=C(NN(C2=O)C3=CC=C(C=C3)C)C |
Product Overview
AC1NUGZQ (CAS 332017-40-0), with molecular formula C21H21N3O3 and molecular weight 363.1583 g/mol. IUPAC: ethyl 4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]benzoate.