(2,3-Dihydro-1H-inden-2-yl)(phenyl)ammonium chloride
2,3-dihydro-1H-inden-2-yl(phenyl)azanium chloride
Also Known As: ammoniumchloride|(2,3-Dihydro-1H-inden-2-yl)(phenyl)ammonium chloride|EINECS 251-417-1|2,3-dihydro-1H-inden-2-yl(phenyl)azanium;chloride|2,3-dihydro-1H-inden-2-yl(phenyl)azanium chloride|2,3-dihydro-1H-inden-2-yl(phenyl)azanium,chloride|1H-Inden-2-amine,2,3-dihydro-N-phenyl-, hydrochloride (1:1)|1H-Inden-2-amine,2,3-dihydro-N-phenyl-,hydrochloride (1:1)
| Molecular Formula | C15H16ClN |
|---|---|
| Molecular Weight | 245.09712 g/mol |
| LogP | -0.9471 |
| Topological Polar Surface Area | 16.61 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 2 |
| Exact Mass | 245.09712 |
| Monoisotopic Mass | 245.09712 |
| Heavy Atoms | 17 |
| Complexity | 456.2903 |
Chemical Identifiers
| CAS Number | 33237-73-9 |
|---|---|
| SMILES | C1C(CC2=CC=CC=C21)[NH2+]C3=CC=CC=C3.[Cl-] |
Product Overview
(2,3-Dihydro-1H-inden-2-yl)(phenyl)ammonium chloride (CAS 33237-73-9), with molecular formula C15H16ClN and molecular weight 245.09712 g/mol. IUPAC: 2,3-dihydro-1H-inden-2-yl(phenyl)azanium chloride.
(2,3-Dihydro-1H-inden-2-yl)(phenyl)ammonium chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »