3-(4-Chlorophenyl)-5-isoxazolecarboxylic acid
3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid
Also Known As: 3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid|3-(4-chlorophenyl)isoxazole-5-carboxylic acid|5-Isoxazolecarboxylic acid, 3-(4-chlorophenyl)-|3-(4-chlorophenyl)-5-isoxazolecarboxylic acid|3-(4-Chloro-phenyl)-isoxazole-5-carboxylic acid|(3'-Chlorobiphenyl-4-yl)acetic acid|BAS 07726824|KS-0000056P|11L-366S|2-hydroxy-4-(trifluoromethyl)benzoic acid|3-(4-chlorophenyl)isoxazole-5-carboxylicacid|5-(4-Chlorophenyl)isoxazole-3-carboxylic acid|82C223|3-(4-chlorophenyl)-isoxazole-5-carboxylic acid|870-726-8
| Molecular Formula | C10H6ClNO3 |
|---|---|
| Molecular Weight | 223.00362 g/mol |
| LogP | 2.6932 |
| Topological Polar Surface Area | 63.33 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 223.00362 |
| Monoisotopic Mass | 223.00362 |
| Heavy Atoms | 15 |
| Complexity | 489.62354 |
Chemical Identifiers
| CAS Number | 33282-22-3 |
|---|---|
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)C(=O)O)Cl |
Product Overview
3-(4-Chlorophenyl)-5-isoxazolecarboxylic acid (CAS 33282-22-3), with molecular formula C10H6ClNO3 and molecular weight 223.00362 g/mol. IUPAC: 3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid.