N-trimethylsilyl-6-trimethylsilyloxynaphthalen-2-amine
N-trimethylsilyl-6-trimethylsilyloxynaphthalen-2-amine
Also Known As: N- -6- -2-naphthalenamine|N-trimethylsilyl-6-trimethylsilyloxynaphthalen-2-amine|N-(Trimethylsilyl)-6-(trimethylsilyloxy)-2-naphthalenamine|1,1,1-trimethyl-N-{6-[(trimethylsilyl)oxy]naphthalen-2-yl}silanamine|Silylamine, 1,1,1-trimethyl-N-[6-(trimethylsiloxy)-2-naphthyl]-|N-(Trimethylsilyl)-N-(6-[(trimethylsilyl)oxy]-2-naphthyl)amine|N-(Trimethylsilyl)-N-(6-[(trimethylsilyl)oxy]-2-naphthyl)amine #
| Molecular Formula | C16H25NOSi2 |
|---|---|
| Molecular Weight | 303.14746 g/mol |
| LogP | 5.3003 |
| Topological Polar Surface Area | 21.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 303.14746 |
| Monoisotopic Mass | 303.14746 |
| Heavy Atoms | 20 |
| Complexity | 321.0 |
Chemical Identifiers
| CAS Number | 33285-85-7 |
|---|---|
| SMILES | C[Si](C)(C)NC1=CC2=C(C=C1)C=C(C=C2)O[Si](C)(C)C |
| InChIKey | GUVKVEDURBXZRH-UHFFFAOYSA-N |
Product Overview
N-trimethylsilyl-6-trimethylsilyloxynaphthalen-2-amine (CAS 33285-85-7), with molecular formula C16H25NOSi2 and molecular weight 303.14746 g/mol. IUPAC: N-trimethylsilyl-6-trimethylsilyloxynaphthalen-2-amine.
N-trimethylsilyl-6-trimethylsilyloxynaphthalen-2-amine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »