1-Naphthalenecarboxylic acid, 3,4-dihydro-
3,4-dihydronaphthalene-1-carboxylic acid
Also Known As: 3,4-dihydronaphthalene-1-carboxylic acid|1-Naphthalenecarboxylic acid, 3,4-dihydro-|3,4-DIHYDRO-1-NAPHTHOICACID|3,4-dihydro-Naphthoic Acid|3,4-Dihydro-.alpha.-naphthoic acid|3,4-Dihydro-1-naphthoic acid|3,4-Dihydro-alpha-naphthoic acid|34-Dihydronaphthalene-1-carboxylic acid|1-Naphthalenecarboxylic acid,3,4-dihydro|3,4-Dihydro-1-naphthalenecarboxylic acid #|3 pound not4-Dihydronaphthalene-1-carboxylic acid|3,4-Dihydro-1-naphthalenecarboxylic acid, AldrichCPR
| Molecular Formula | C11H10O2 |
|---|---|
| Molecular Weight | 174.06808 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 174.06808 |
| Monoisotopic Mass | 174.06808 |
| Heavy Atoms | 13 |
| Complexity | 242.0 |
Chemical Identifiers
| CAS Number | 3333-23-1 |
|---|---|
| SMILES | C1CC2=CC=CC=C2C(=C1)C(=O)O |
| InChIKey | JNPFDSPGHQBUPF-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-Naphthalenecarboxylic acid, 3,4-dihydro- (CAS 3333-23-1), with molecular formula C11H10O2 and molecular weight 174.06808 g/mol. IUPAC: 3,4-dihydronaphthalene-1-carboxylic acid.