![Ethyl 2-[(4-methoxy-3-nitrobenzoyl)amino]benzoate structure](/static/products/333/333350-07-5.png)
Ethyl 2-[(4-methoxy-3-nitrobenzoyl)amino]benzoate
ethyl 2-[(4-methoxy-3-nitrobenzoyl)amino]benzoate
Also Known As: Oprea1_486692|Oprea1_586856|BAS 00785181|Ethyl 2-[(4-methoxy-3-nitrobenzoyl)amino]benzoate|ethyl 2-{[(4-methoxy-3-nitrophenyl)carbonyl]amino}benzoate|AK-968/11844689|ethyl 2-({3-nitro-4-methoxybenzoyl}amino)benzoate|SR-01000478402-1|ETHYL 2-(4-METHOXY-3-NITROBENZAMIDO)BENZOATE|Ethyl 2-[(4-methoxy-3-nitrobenzoyl)amino]benzoate #|ethyl 2-[(4-methoxy-3-nitrophenyl)carbonylamino]benzoate|2-(4-Methoxy-3-nitro-benzoylamino)-benzoic acid ethyl ester|Benzoic acid, 2-(4-methoxy-3-nitrobenzoylamino)-, ethyl ester
| Molecular Formula | C17H16N2O6 |
|---|---|
| Molecular Weight | 344.10083 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 110.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Exact Mass | 344.10083 |
| Monoisotopic Mass | 344.10083 |
| Heavy Atoms | 25 |
| Complexity | 492.0 |
Chemical Identifiers
| CAS Number | 333350-07-5 |
|---|---|
| SMILES | CCOC(=O)C1=CC=CC=C1NC(=O)C2=CC(=C(C=C2)OC)[N+](=O)[O-] |
| InChIKey | WJGJPPCLEQZISK-UHFFFAOYSA-N |
Product Overview
Ethyl 2-[(4-methoxy-3-nitrobenzoyl)amino]benzoate (CAS 333350-07-5), with molecular formula C17H16N2O6 and molecular weight 344.10083 g/mol. IUPAC: ethyl 2-[(4-methoxy-3-nitrobenzoyl)amino]benzoate.