(4-Methoxy-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone
(4-methoxy-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone
Also Known As: Oprea1_402412|Oprea1_448015|BAS 00785091|(4-methoxy-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone|4-methoxy-3-nitrophenyl 4-phenylpiperazinyl ketone|SR-01000478391-1|1-(4-METHOXY-3-NITROBENZOYL)-4-PHENYLPIPERAZINE|(4-methoxy-3-nitrophenyl)(4-phenylpiperazin-1-yl)methanone|(4-Methoxy-3-nitro-phenyl)-(4-phenyl-piperazin-1-yl)-methanone
| Molecular Formula | C18H19N3O4 |
|---|---|
| Molecular Weight | 341.13754 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 78.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 341.13754 |
| Monoisotopic Mass | 341.13754 |
| Heavy Atoms | 25 |
| Complexity | 467.0 |
Chemical Identifiers
| CAS Number | 333350-17-7 |
|---|---|
| SMILES | COC1=C(C=C(C=C1)C(=O)N2CCN(CC2)C3=CC=CC=C3)[N+](=O)[O-] |
| InChIKey | VRHIFKIMRXOVHD-UHFFFAOYSA-N |
Product Overview
(4-Methoxy-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone (CAS 333350-17-7), with molecular formula C18H19N3O4 and molecular weight 341.13754 g/mol. IUPAC: (4-methoxy-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone.
(4-Methoxy-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »