N-(4-phenylmethoxyphenyl)thiophene-2-carboxamide
N-(4-phenylmethoxyphenyl)thiophene-2-carboxamide
Also Known As: Oprea1_356337|Oprea1_543161|BAS 00792532|N-(4-phenylmethoxyphenyl)thiophene-2-carboxamide|N-[4-(benzyloxy)phenyl]thiophene-2-carboxamide|N-(4-(benzyloxy)phenyl)thiophene-2-carboxamide|N-[4-(benzyloxy)phenyl]-2-thiophenecarboxamide|AE-848/10301015|AG-690/12767849|N-[4-(phenylmethoxy)phenyl]-2-thienylcarboxamide|Thiophene-2-carboxylic acid (4-benzyloxy-phenyl)-amide|SR-01000414898-1
| Molecular Formula | C18H15NO2S |
|---|---|
| Molecular Weight | 309.08234 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 66.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 309.08234 |
| Monoisotopic Mass | 309.08234 |
| Heavy Atoms | 22 |
| Complexity | 349.0 |
Chemical Identifiers
| CAS Number | 333353-90-5 |
|---|---|
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)NC(=O)C3=CC=CS3 |
| InChIKey | RJZWNXSYFCYEJW-UHFFFAOYSA-N |
Product Overview
N-(4-phenylmethoxyphenyl)thiophene-2-carboxamide (CAS 333353-90-5), with molecular formula C18H15NO2S and molecular weight 309.08234 g/mol. IUPAC: N-(4-phenylmethoxyphenyl)thiophene-2-carboxamide.
N-(4-phenylmethoxyphenyl)thiophene-2-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »