4-([(Methylsulfonyl)(phenyl)amino]methyl)benzoic acid
4-[(N-methylsulfonylanilino)methyl]benzoic acid
Also Known As: Oprea1_174871|Oprea1_536141|4-([(Methylsulfonyl)(phenyl)amino]methyl)benzoic acid|4-[(N-methylsulfonylanilino)methyl]benzoic acid|BAS 00794338|4-{[(Methylsulfonyl)(phenyl)amino]methyl}benzoic acid|4-{[(methylsulfonyl)anilino]methyl}benzoic acid|AB00094359-01|4-((N-phenylmethylsulfonamido)methyl)benzoic acid|AE-641/12110056|benzoic acid, 4-[[(methylsulfonyl)phenylamino]methyl]-|4-[(N-PHENYLMETHANESULFONAMIDO)METHYL]BENZOIC ACID|4-([(Methylsulfonyl)(phenyl)amino]methyl)benzoicacid|4-[(Methanesulfonyl-phenyl-amino)-methyl]-benzoic acid|4-[[(METHYLSULFONYL)(PHENYL)AMINO]METHYL]BENZOIC ACID
| Molecular Formula | C15H15NO4S |
|---|---|
| Molecular Weight | 305.07217 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 83.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 305.07217 |
| Monoisotopic Mass | 305.07217 |
| Heavy Atoms | 21 |
| Complexity | 443.0 |
Chemical Identifiers
| CAS Number | 333357-35-0 |
|---|---|
| SMILES | CS(=O)(=O)N(CC1=CC=C(C=C1)C(=O)O)C2=CC=CC=C2 |
| InChIKey | JFUWLPUHRWSDBJ-UHFFFAOYSA-N |
Product Overview
4-([(Methylsulfonyl)(phenyl)amino]methyl)benzoic acid (CAS 333357-35-0), with molecular formula C15H15NO4S and molecular weight 305.07217 g/mol. IUPAC: 4-[(N-methylsulfonylanilino)methyl]benzoic acid.
4-([(Methylsulfonyl)(phenyl)amino]methyl)benzoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »