Toluene-2,4-disulfonyl chloride
4-methylbenzene-1,3-disulfonyl chloride
Also Known As: Toluene-2,4-disulfonyl chloride|4-methylbenzene-1,3-disulfonyl dichloride|4-methylbenzene-1,3-disulfonyl chloride|Toluene-2,4-bis-sulphonyl chloride|4-methylbenzene-1,3-disulfonylchloride|Toluene-2,4-disulfonic acid dichloride|4-methylbenzene-1,3-disulfonyldichloride|4-Methyl-1,3-benzenedisulfonyl dichloride|1,3-Benzenedisulfonyldichloride, 4-methyl-|1,3-Benzenedisulfonyl dichloride, 4-methyl-|4-Methyl-1,3-benzenebis(sulfonic acid chloride)
| Molecular Formula | C7H6Cl2O4S2 |
|---|---|
| Molecular Weight | 287.90845 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 85.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 287.90845 |
| Monoisotopic Mass | 287.90845 |
| Heavy Atoms | 15 |
| Complexity | 417.0 |
Chemical Identifiers
| CAS Number | 33342-30-2 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)S(=O)(=O)Cl |
| InChIKey | CLMMQDZNOXYEBU-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Toluene-2,4-disulfonyl chloride (CAS 33342-30-2), with molecular formula C7H6Cl2O4S2 and molecular weight 287.90845 g/mol. IUPAC: 4-methylbenzene-1,3-disulfonyl chloride.