(3-Methoxyphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone
(3-methoxyphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone
Also Known As: Oprea1_082911|Oprea1_247146|BAS 03050014|1-(3-methoxybenzoyl)-4-(methylsulfonyl)piperazine|(3-methoxyphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone|AT-057/43313942|(4-Methanesulfonyl-piperazin-1-yl)-(3-methoxy-phenyl)-methanone|3-methoxyphenyl 4-(methylsulfonyl)piperazinyl ketone|SR-01000475583-1|1-METHANESULFONYL-4-(3-METHOXYBENZOYL)PIPERAZINE|(3-methoxyphenyl)[4-(methylsulfonyl)piperazin-1-yl]methanone|(3-METHOXYPHENYL)[4-(METHYLSULFONYL)PIPERAZINO]METHANONE
| Molecular Formula | C13H18N2O4S |
|---|---|
| Molecular Weight | 298.09872 g/mol |
| LogP | 0.4 |
| Topological Polar Surface Area | 75.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 298.09872 |
| Monoisotopic Mass | 298.09872 |
| Heavy Atoms | 20 |
| Complexity | 438.0 |
Chemical Identifiers
| CAS Number | 333756-75-5 |
|---|---|
| SMILES | COC1=CC=CC(=C1)C(=O)N2CCN(CC2)S(=O)(=O)C |
| InChIKey | OBJMYFSVQAFURS-UHFFFAOYSA-N |
Product Overview
(3-Methoxyphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone (CAS 333756-75-5), with molecular formula C13H18N2O4S and molecular weight 298.09872 g/mol. IUPAC: (3-methoxyphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone.
(3-Methoxyphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »