RefChem:129608
Also Known As: EINECS 206-385-3|Kalium-perfluor-4-aethylcyclohexan-sulfonat|Potassium salt of perfluoro-4-ethylcyclohexylsulfonic acid|Potassium 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(pentafluoroethyl)cyclohexanesulphonate|Cyclohexanesulfonic acid, 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)-, potassium salt (1:1)|DECAFLUORO-4-(PENTAFLUOROETHYL)CYCLOHEXANESULFONIC ACID POTASSIUM SALT|Cyclohexanesulfonic acid, 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(pentafluoroethyl)-, potassium salt|potassium,1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentaf|1,2,2,3,3,4,5,5,6,6-decafluoro-4-(pentafluoroethyl)-cyclohexanesulfonicaci|1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonic acid; potassium
| Molecular Formula | C8HF15KO3S |
|---|---|
| Molecular Weight | 500.9044 g/mol |
| LogP | 3.6199 |
| Topological Polar Surface Area | 54.37 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 500.9044 |
| Monoisotopic Mass | 500.9044 |
| Heavy Atoms | 28 |
| Complexity | 712.8752 |
Chemical Identifiers
| CAS Number | 335-24-0 |
|---|---|
| SMILES | C1(C(C(C(C(C1(F)F)(F)F)(F)S(=O)(=O)O)(F)F)(F)F)(C(C(F)(F)F)(F)F)F.[K] |
Product Overview
RefChem:129608 (CAS 335-24-0), with molecular formula C8HF15KO3S and molecular weight 500.9044 g/mol.