2-(4-Chlorophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole
2-(4-chlorophenyl)-4,4-dimethyl-5H-1,3-oxazole
Also Known As: 2-(4-chlorophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole|2-(4-chlorophenyl)-4,4-dimethyl-5H-1,3-oxazole|2-(4-chlorophenyl)-4,4-dimethyl-4,5-dihydrooxazole|J1.494.290D|2-(4-Chlorophenyl)-4,4-dimethyl-2-oxazoline|oxazole, 2-(4-chlorophenyl)-4,5-dihydro-4,4-dimethyl-|2-(4-CHLOROPHENYL)-4,5-DIHYDRO-4,4-DIMETHYLOXAZOLE|4-chlorophenyl- 4,4-dimethyl-4,5-dihydrooxazole|AJ-292/14597223|SR-01000450494-1|2-(4-chlorophenyl)- 4,4-dimethyl-4,5-dihydrooxazole|2-(4-Chlorophenyl)-4,5-dihydro-4,4- dimethyloxazole
| Molecular Formula | C11H12ClNO |
|---|---|
| Molecular Weight | 209.06075 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 21.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 209.06075 |
| Monoisotopic Mass | 209.06075 |
| Heavy Atoms | 14 |
| Complexity | 242.0 |
Chemical Identifiers
| CAS Number | 33554-30-2 |
|---|---|
| SMILES | CC1(COC(=N1)C2=CC=C(C=C2)Cl)C |
| InChIKey | XCQDCQKNZXMXGM-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(4-Chlorophenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole (CAS 33554-30-2), with molecular formula C11H12ClNO and molecular weight 209.06075 g/mol. IUPAC: 2-(4-chlorophenyl)-4,4-dimethyl-5H-1,3-oxazole.