Sulfone, 4-fluorophenyl 2-piperidinoethyl, hydrochloride
1-[2-(4-fluorophenyl)sulfonylethyl]piperidine;hydrochloride
Also Known As: Sulfone, hydrochloride|Piperidine, hydrochloride|Sulfone, 4-fluorophenyl 2-piperidinoethyl, hydrochloride|4-Fluorophenyl 2-piperidinoethyl sulfone hydrochloride|Piperidine, 1-(2-((p-fluorophenyl)sulfonyl)ethyl)-, hydrochloride|1-[2-(4-fluorophenyl)sulfonylethyl]piperidine hydrochloride|1-[2-(4-fluorophenyl)sulfonylethyl]piperidine,hydrochloride|1-{2-[(4-fluorophenyl)sulfonyl]ethyl}piperidine hydrochloride(1:1)|Piperidine, 1-[2-[(p-fluorophenyl)sulfonyl]ethyl]-, hydrochloride|Piperidine,1-[2-[(4-fluorophenyl)sulfonyl]ethyl]-, hydrochloride (1:1)|1-[2-(4-Fluorobenzene-1-sulfonyl)ethyl]piperidine--hydrogen chloride (1/1)
| Molecular Formula | C13H19ClFNO2S |
|---|---|
| Molecular Weight | 307.0809 g/mol |
| LogP | 2.5071 |
| Topological Polar Surface Area | 45.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 307.0809 |
| Monoisotopic Mass | 307.0809 |
| Heavy Atoms | 19 |
| Complexity | 338.0 |
Chemical Identifiers
| CAS Number | 33580-98-2 |
|---|---|
| SMILES | C1CCN(CC1)CCS(=O)(=O)C2=CC=C(C=C2)F.Cl |
| InChIKey | IMQXJORTCBTZCU-UHFFFAOYSA-N |
Product Overview
Sulfone, 4-fluorophenyl 2-piperidinoethyl, hydrochloride (CAS 33580-98-2), with molecular formula C13H19ClFNO2S and molecular weight 307.0809 g/mol. IUPAC: 1-[2-(4-fluorophenyl)sulfonylethyl]piperidine;hydrochloride.