Ethyl heptafluorobutyrylacetate
ethyl 4,4,5,5,6,6,6-heptafluoro-3-oxohexanoate
Also Known As: Ethyl heptafluorobutyrylacetate|Ethyl heptafluorobutanoylacetate|Ethylheptafluorobutyrylacetate|Ethyl 4,4,5,5,6,6,6-heptafluoro-3-oxohexanoate|ethyl heptafluorobutyryl acetate|2-Benzothiazolepropanamine(9CI)|Ethyl (heptafluorobutyryl)acetate|Ethyl 2H,2H-perfluoro-3-oxohexanoate|Heptafluorobutyrylacetic acid ethyl ester|ETHYL (HEPTAFLUOROBUTANOYL)ACETATE|ethyl 4,4,5,5,6,6,6-heptafluoro-3-oxo-hexanoate|4,4,5,5,6,6,6-heptafluoro-3-oxohexanoic acid ethyl ester|Ethyl 4,4,5,5,6,6,6-heptafluoro-3-oxohexanoate #|4,4,5,5,6,6,6-heptafluoro-3-oxo-hexanoic acid ethyl ester|ethyl 4,4,5,5,6,6,6-heptakis(fluoranyl)-3-oxidanylidene-hexanoate
| Molecular Formula | C8H7F7O3 |
|---|---|
| Molecular Weight | 284.02835 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 43.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Exact Mass | 284.02835 |
| Monoisotopic Mass | 284.02835 |
| Heavy Atoms | 18 |
| Complexity | 334.0 |
Chemical Identifiers
| CAS Number | 336-62-9 |
|---|---|
| SMILES | CCOC(=O)CC(=O)C(C(C(F)(F)F)(F)F)(F)F |
| InChIKey | CMGCMFZWEPCGSQ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl heptafluorobutyrylacetate (CAS 336-62-9), with molecular formula C8H7F7O3 and molecular weight 284.02835 g/mol. IUPAC: ethyl 4,4,5,5,6,6,6-heptafluoro-3-oxohexanoate.