Diphenyl (phenylamino)(pyridin-4-yl)methylphosphonate
N-[diphenoxyphosphoryl(pyridin-4-yl)methyl]aniline
Also Known As: diphenyl (phenylamino)(pyridin-4-yl)methylphosphonate|N-[diphenoxyphosphoryl(pyridin-4-yl)methyl]aniline|Diphenyl ((phenylamino)(pyridin-4-yl)methyl)phosphonate|Diphenyl [anilino(pyridin-4-yl)methyl]phosphonate|diphenyl(phenylamino)(pyridin-4-yl)methylphosphonate|diphenyl [(phenylamino)(pyridin-4-yl)methyl]phosphonate|((phenylamino)-(4-pyridylmethyl)]phosphonic acid diphenyl ester|[(phenylamino)-(4-pyridylmethyl)]phosphonic acid diphenyl ester|[(phenylamino)-4-pyridinylmethyl]phosphonic acid diphenyl ester|[(Phenylamino)(4-pyridinyl)methyl]phosphonic acid diphenyl ester
| Molecular Formula | C24H21N2O3P |
|---|---|
| Molecular Weight | 416.12897 g/mol |
| LogP | 5.3 |
| Topological Polar Surface Area | 60.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Exact Mass | 416.12897 |
| Monoisotopic Mass | 416.12897 |
| Heavy Atoms | 30 |
| Complexity | 513.0 |
Chemical Identifiers
| CAS Number | 3360-72-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)NC(C2=CC=NC=C2)P(=O)(OC3=CC=CC=C3)OC4=CC=CC=C4 |
| InChIKey | CVOHYHGGAFQJDU-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Diphenyl (phenylamino)(pyridin-4-yl)methylphosphonate (CAS 3360-72-3), with molecular formula C24H21N2O3P and molecular weight 416.12897 g/mol. IUPAC: N-[diphenoxyphosphoryl(pyridin-4-yl)methyl]aniline.