4,4'-Diamino-3-biphenylyl hydrogen sulfate
[2-amino-5-(4-aminophenyl)phenyl] hydrogen sulfate
Also Known As: Benzidin-3-yl hydrogen sulfate|Benzidin-3-yl hydrogen sulphate|Sulfuric acid, benzidin-3-yl ester|4,4'-Diamino-3-biphenylyl hydrogen sulfate|4,4'-Diamino-3-diphenylyl hydrogen sulfate|4,4'-Diamino-3-diphenylyl hydrogen sulphate|Sulfuric acid hydrogen benzidin-3-yl ester|3-HYDROXYBENZIDINE HYDROGEN SULFATE ESTER|[2-amino-5-(4-aminophenyl)phenyl] hydrogen sulfate|Phenol, 2-amino-5-(p-aminophenyl)-, hydrogen sulfate (ester)|4,4'-Diamino[1,1'-biphenyl]-3-yl hydrogen sulfate|(1,1'-BIPHENYL)-3-OL, 4,4'-DIAMINO-, 3-(HYDROGEN SULFATE)|{4,4'-diamino-[1,1'-biphenyl]-3-yl}oxidanesulfonic acid|Sulfuric acid hydrogen 4,4 -diaminobiphenyl-3-yl ester|(1,1'-BIPHENYL)-3-OL, 4,4'-DIAMINO-, HYDROGEN SULFATE (ESTER)|[1,1'-Biphenyl]-3-ol, 4,4'-diamino-, hydrogen sulfate (ester)
| Molecular Formula | C12H12N2O4S |
|---|---|
| Molecular Weight | 280.0518 g/mol |
| LogP | 1.2 |
| Topological Polar Surface Area | 124.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Exact Mass | 280.0518 |
| Monoisotopic Mass | 280.0518 |
| Heavy Atoms | 19 |
| Complexity | 387.0 |
Chemical Identifiers
| CAS Number | 3365-94-4 |
|---|---|
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)N)OS(=O)(=O)O)N |
| InChIKey | VOERXDBQWZMNDQ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4,4'-Diamino-3-biphenylyl hydrogen sulfate (CAS 3365-94-4), with molecular formula C12H12N2O4S and molecular weight 280.0518 g/mol. IUPAC: [2-amino-5-(4-aminophenyl)phenyl] hydrogen sulfate.
4,4'-Diamino-3-biphenylyl hydrogen sulfate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »