(S)-2-(3-Phenylureido)propanoic acid
(2S)-2-(phenylcarbamoylamino)propanoic acid
Also Known As: L-Alanine, N-[(phenylamino)carbonyl]-|N-(anilinocarbonyl)-L-alanine|(S)-2-(3-Phenylureido)propanoic acid|2-(phenylcarbamoylamino)propanoic Acid|(2S)-2-(phenylcarbamoylamino)propanoic acid|(2S)-2-[(PHENYLCARBAMOYL)AMINO]PROPANOIC ACID|(2S)-2-[(anilinocarbonyl)amino]propanoic acid|ethyl 5-fluoro-1H-benzofuran-2-carboxylate|(2S)-2-[(PHENYLCARBAMOYL)AMINO]PROPANOICACID
| Molecular Formula | C10H12N2O3 |
|---|---|
| Molecular Weight | 208.0848 g/mol |
| LogP | 0.9 |
| Topological Polar Surface Area | 78.4 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 208.0848 |
| Monoisotopic Mass | 208.0848 |
| Heavy Atoms | 15 |
| Complexity | 237.0 |
Chemical Identifiers
| CAS Number | 33653-68-8 |
|---|---|
| SMILES | C[C@@H](C(=O)O)NC(=O)NC1=CC=CC=C1 |
| InChIKey | SWIUEMANOAFYHY-ZETCQYMHSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(S)-2-(3-Phenylureido)propanoic acid (CAS 33653-68-8), with molecular formula C10H12N2O3 and molecular weight 208.0848 g/mol. IUPAC: (2S)-2-(phenylcarbamoylamino)propanoic acid.
(S)-2-(3-Phenylureido)propanoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »